C18H27NO4 — CID 119359679
(2S)-2-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylbutanoic acid (PubChem CID 119359679) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S)-2-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119359679 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2S)-2-[5-(2,5-dimethylphenoxy)pentanoylamino]-3-methylbutanoic acid |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N[C@H](C(=O)O)C(C)C)c1 |
| InChI | InChI=1S/C18H27NO4/c1-12(2)17(18(21)22)19-16(20)7-5-6-10-23-15-11-13(3)8-9-14(15)4/h8-9,11-12,17H,5-7,10H2,1-4H3,(H,19,20)(H,21,22)/t17-/m0/s1 |
| InChIKey | GWBQCRADJQRZSV-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|