C19H29NO4 — CID 119207373
3-[5-(2,5-dimethylphenoxy)pentanoyl-propan-2-ylamino]propanoic acid (PubChem CID 119207373) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 3-[5-(2,5-dimethylphenoxy)pentanoyl-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[5-(2,5-dimethylphenoxy)pentanoyl-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119207373 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[5-(2,5-dimethylphenoxy)pentanoyl-propan-2-ylamino]propanoic acid |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N(CCC(=O)O)C(C)C)c1 |
| InChI | InChI=1S/C19H29NO4/c1-14(2)20(11-10-19(22)23)18(21)7-5-6-12-24-17-13-15(3)8-9-16(17)4/h8-9,13-14H,5-7,10-12H2,1-4H3,(H,22,23) |
| InChIKey | QUUOZCKXWZOOKK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|