C21H34N2O3 — CID 54784103
5-(2,5-dimethylphenoxy)-N'-hexanoyl-2,2-dimethylpentanehydrazide (PubChem CID 54784103) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N'-hexanoyl-2,2-dimethylpentanehydrazide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N'-hexanoyl-2,2-dimethylpentanehydrazide |
|---|---|
| PubChem CID | 54784103 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N'-hexanoyl-2,2-dimethylpentanehydrazide |
| SMILES | CCCCCC(=O)NNC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C21H34N2O3/c1-6-7-8-10-19(24)22-23-20(25)21(4,5)13-9-14-26-18-15-16(2)11-12-17(18)3/h11-12,15H,6-10,13-14H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | NAWZEYJNAABENW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|