C22H27N3O5 — CID 54784113
N'-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-4-nitrobenzohydrazide (PubChem CID 54784113) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is N'-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 54784113 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N'-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-4-nitrobenzohydrazide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-15-6-7-16(2)19(14-15)30-13-5-12-22(3,4)21(27)24-23-20(26)17-8-10-18(11-9-17)25(28)29/h6-11,14H,5,12-13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | CRKNXWXRKWFMPD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|