C17H25NO6 — CID 118520488
1-nitrooxyethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (PubChem CID 118520488) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-nitrooxyethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | 1-nitrooxyethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 118520488 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-nitrooxyethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)OC(C)O[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25NO6/c1-12-7-8-13(2)15(11-12)22-10-6-9-17(4,5)16(19)23-14(3)24-18(20)21/h7-8,11,14H,6,9-10H2,1-5H3 |
| InChIKey | WBZVMZBVJCXKOI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|