C22H26N2O6 — CID 141462015
2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4-nitrobenzoic acid (PubChem CID 141462015) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4-nitrobenzoic acid.
| Compound Name | 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 141462015 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4-nitrobenzoic acid |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2cc([N+](=O)[O-])ccc2C(=O)O)c1 |
| InChI | InChI=1S/C22H26N2O6/c1-14-6-7-15(2)19(12-14)30-11-5-10-22(3,4)21(27)23-18-13-16(24(28)29)8-9-17(18)20(25)26/h6-9,12-13H,5,10-11H2,1-4H3,(H,23,27)(H,25,26) |
| InChIKey | WBNRPQAHKZSQPE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|