C15H23NaO3 — CID 173009199
sodium;5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;hydride (PubChem CID 173009199) has the molecular formula C15H23NaO3 and a molecular weight of 274.34 g/mol. Its IUPAC name is sodium;5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;hydride.
| Compound Name | sodium;5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;hydride |
|---|---|
| PubChem CID | 173009199 |
| Molecular Formula | C15H23NaO3 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | sodium;5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;hydride |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C15H22O3.Na.H/c1-11-6-7-12(2)13(10-11)18-9-5-8-15(3,4)14(16)17;;/h6-7,10H,5,8-9H2,1-4H3,(H,16,17);;/q;+1;-1 |
| InChIKey | DYVASTJULMMAMB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|