C23H28O3 — CID 158659944
5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;octa-2,4,6-triyne (PubChem CID 158659944) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;octa-2,4,6-triyne.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;octa-2,4,6-triyne |
|---|---|
| PubChem CID | 158659944 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid;octa-2,4,6-triyne |
| SMILES | CC#CC#CC#CC.Cc1ccc(C)c(OCCCC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C15H22O3.C8H6/c1-11-6-7-12(2)13(10-11)18-9-5-8-15(3,4)14(16)17;1-3-5-7-8-6-4-2/h6-7,10H,5,8-9H2,1-4H3,(H,16,17);1-2H3 |
| InChIKey | ICPZNDDLINOIIM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|