C38H48O7 — CID 71731109
[4-acetyl-3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxyphenyl] 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (PubChem CID 71731109) has the molecular formula C38H48O7 and a molecular weight of 616.80 g/mol. Its IUPAC name is [4-acetyl-3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxyphenyl] 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | [4-acetyl-3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxyphenyl] 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 71731109 |
| Molecular Formula | C38H48O7 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | [4-acetyl-3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxyphenyl] 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| SMILES | CC(=O)c1ccc(OC(=O)C(C)(C)CCCOc2cc(C)ccc2C)cc1OC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C38H48O7/c1-25-12-14-27(3)32(22-25)42-20-10-18-37(6,7)35(40)44-30-16-17-31(29(5)39)34(24-30)45-36(41)38(8,9)19-11-21-43-33-23-26(2)13-15-28(33)4/h12-17,22-24H,10-11,18-21H2,1-9H3 |
| InChIKey | JWQFSEDPTVUBMH-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|