C20H28O3 — CID 176607282
pent-4-ynyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (PubChem CID 176607282) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is pent-4-ynyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | pent-4-ynyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 176607282 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | pent-4-ynyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| SMILES | C#CCCCOC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C20H28O3/c1-6-7-8-13-23-19(21)20(4,5)12-9-14-22-18-15-16(2)10-11-17(18)3/h1,10-11,15H,7-9,12-14H2,2-5H3 |
| InChIKey | GXAMIQCEXUIJIR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|