C12H14O — CID 63657851
2-but-3-ynoxy-1,4-dimethylbenzene (PubChem CID 63657851) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-but-3-ynoxy-1,4-dimethylbenzene.
| Compound Name | 2-but-3-ynoxy-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 63657851 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-but-3-ynoxy-1,4-dimethylbenzene |
| SMILES | C#CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C12H14O/c1-4-5-8-13-12-9-10(2)6-7-11(12)3/h1,6-7,9H,5,8H2,2-3H3 |
| InChIKey | XBXFAZCFWZZUQW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|