C9H13NO — CID 89376053
(2,5-dimethylphenoxy)methanamine (PubChem CID 89376053) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (2,5-dimethylphenoxy)methanamine.
| Compound Name | (2,5-dimethylphenoxy)methanamine |
|---|---|
| PubChem CID | 89376053 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (2,5-dimethylphenoxy)methanamine |
| SMILES | Cc1ccc(C)c(OCN)c1 |
| InChI | InChI=1S/C9H13NO/c1-7-3-4-8(2)9(5-7)11-6-10/h3-5H,6,10H2,1-2H3 |
| InChIKey | XTZHUFYDBQNABE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|