C24H32O2 — CID 160770501
2-(cyclopropylmethoxy)-1,4-dimethylbenzene (PubChem CID 160770501) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-1,4-dimethylbenzene.
| Compound Name | 2-(cyclopropylmethoxy)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 160770501 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-(cyclopropylmethoxy)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(OCC2CC2)c1.Cc1ccc(C)c(OCC2CC2)c1 |
| InChI | InChI=1S/2C12H16O/c2*1-9-3-4-10(2)12(7-9)13-8-11-5-6-11/h2*3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | RZGDRGYICHLCKM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |