C12H16O2 — CID 116820130
3-[(2,5-dimethylphenoxy)methyl]oxetane (PubChem CID 116820130) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenoxy)methyl]oxetane.
| Compound Name | 3-[(2,5-dimethylphenoxy)methyl]oxetane |
|---|---|
| PubChem CID | 116820130 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-[(2,5-dimethylphenoxy)methyl]oxetane |
| SMILES | Cc1ccc(C)c(OCC2COC2)c1 |
| InChI | InChI=1S/C12H16O2/c1-9-3-4-10(2)12(5-9)14-8-11-6-13-7-11/h3-5,11H,6-8H2,1-2H3 |
| InChIKey | CABKTJTUBVFOLL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |