C13H18O2 — CID 71627927
2-[(2,5-dimethylphenoxy)methyl]oxolane (PubChem CID 71627927) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenoxy)methyl]oxolane.
| Compound Name | 2-[(2,5-dimethylphenoxy)methyl]oxolane |
|---|---|
| PubChem CID | 71627927 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-[(2,5-dimethylphenoxy)methyl]oxolane |
| SMILES | Cc1ccc(C)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C13H18O2/c1-10-5-6-11(2)13(8-10)15-9-12-4-3-7-14-12/h5-6,8,12H,3-4,7,9H2,1-2H3 |
| InChIKey | RUHWEHBFGWVPBH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |