C12H16O4S — CID 165449244
5-methyl-2-(oxolan-2-ylmethoxy)benzenesulfinic acid (PubChem CID 165449244) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 5-methyl-2-(oxolan-2-ylmethoxy)benzenesulfinic acid.
| Compound Name | 5-methyl-2-(oxolan-2-ylmethoxy)benzenesulfinic acid |
|---|---|
| PubChem CID | 165449244 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-methyl-2-(oxolan-2-ylmethoxy)benzenesulfinic acid |
| SMILES | Cc1ccc(OCC2CCCO2)c(S(=O)O)c1 |
| InChI | InChI=1S/C12H16O4S/c1-9-4-5-11(12(7-9)17(13)14)16-8-10-3-2-6-15-10/h4-5,7,10H,2-3,6,8H2,1H3,(H,13,14) |
| InChIKey | GQMWTYLZIVYSPS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|