C12H15BF3KO2 — CID 63676205
potassium trifluoro-[5-methyl-2-(oxolan-2-ylmethoxy)phenyl]boranuide (PubChem CID 63676205) has the molecular formula C12H15BF3KO2 and a molecular weight of 298.15 g/mol. Its IUPAC name is potassium trifluoro-[5-methyl-2-(oxolan-2-ylmethoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[5-methyl-2-(oxolan-2-ylmethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 63676205 |
| Molecular Formula | C12H15BF3KO2 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | potassium trifluoro-[5-methyl-2-(oxolan-2-ylmethoxy)phenyl]boranuide |
| SMILES | Cc1ccc(OCC2CCCO2)c([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C12H15BF3O2.K/c1-9-4-5-12(11(7-9)13(14,15)16)18-8-10-3-2-6-17-10;/h4-5,7,10H,2-3,6,8H2,1H3;/q-1;+1 |
| InChIKey | LYSGQWJZSQHFBJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|