C12H15BF3O2- — CID 106929979
[2-(cyclopropylmethoxymethoxy)-5-methylphenyl]-trifluoroboranuide (PubChem CID 106929979) has the molecular formula C12H15BF3O2- and a molecular weight of 259.06 g/mol. Its IUPAC name is [2-(cyclopropylmethoxymethoxy)-5-methylphenyl]-trifluoroboranuide.
| Compound Name | [2-(cyclopropylmethoxymethoxy)-5-methylphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 106929979 |
| Molecular Formula | C12H15BF3O2- |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | [2-(cyclopropylmethoxymethoxy)-5-methylphenyl]-trifluoroboranuide |
| SMILES | Cc1ccc(OCOCC2CC2)c([B-](F)(F)F)c1 |
| InChI | InChI=1S/C12H15BF3O2/c1-9-2-5-12(11(6-9)13(14,15)16)18-8-17-7-10-3-4-10/h2,5-6,10H,3-4,7-8H2,1H3/q-1 |
| InChIKey | NRMGCCOEZKJOOV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|