C13H17ClO4S — CID 43591843
5-methyl-2-(oxan-2-ylmethoxy)benzenesulfonyl chloride (PubChem CID 43591843) has the molecular formula C13H17ClO4S and a molecular weight of 304.79 g/mol. Its IUPAC name is 5-methyl-2-(oxan-2-ylmethoxy)benzenesulfonyl chloride.
| Compound Name | 5-methyl-2-(oxan-2-ylmethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43591843 |
| Molecular Formula | C13H17ClO4S |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-methyl-2-(oxan-2-ylmethoxy)benzenesulfonyl chloride |
| SMILES | Cc1ccc(OCC2CCCCO2)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H17ClO4S/c1-10-5-6-12(13(8-10)19(14,15)16)18-9-11-4-2-3-7-17-11/h5-6,8,11H,2-4,7,9H2,1H3 |
| InChIKey | GZAXMOWEVRRZSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |