C12H14BrClO4S — CID 63217137
5-bromo-3-methyl-2-(oxolan-2-ylmethoxy)benzenesulfonyl chloride (PubChem CID 63217137) has the molecular formula C12H14BrClO4S and a molecular weight of 369.66 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-(oxolan-2-ylmethoxy)benzenesulfonyl chloride.
| Compound Name | 5-bromo-3-methyl-2-(oxolan-2-ylmethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63217137 |
| Molecular Formula | C12H14BrClO4S |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 5-bromo-3-methyl-2-(oxolan-2-ylmethoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)Cl)c1OCC1CCCO1 |
| InChI | InChI=1S/C12H14BrClO4S/c1-8-5-9(13)6-11(19(14,15)16)12(8)18-7-10-3-2-4-17-10/h5-6,10H,2-4,7H2,1H3 |
| InChIKey | FGXSPGDPQLXSQO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |