C10H11BrClNO4S — CID 82921454
2-(3-amino-3-oxopropoxy)-5-bromo-3-methylbenzenesulfonyl chloride (PubChem CID 82921454) has the molecular formula C10H11BrClNO4S and a molecular weight of 356.63 g/mol. Its IUPAC name is 2-(3-amino-3-oxopropoxy)-5-bromo-3-methylbenzenesulfonyl chloride.
| Compound Name | 2-(3-amino-3-oxopropoxy)-5-bromo-3-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82921454 |
| Molecular Formula | C10H11BrClNO4S |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 2-(3-amino-3-oxopropoxy)-5-bromo-3-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)Cl)c1OCCC(N)=O |
| InChI | InChI=1S/C10H11BrClNO4S/c1-6-4-7(11)5-8(18(12,15)16)10(6)17-3-2-9(13)14/h4-5H,2-3H2,1H3,(H2,13,14) |
| InChIKey | LGUPYNBTDALEFR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |