C14H13BrClNO3S — CID 82911733
5-bromo-3-methyl-2-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride (PubChem CID 82911733) has the molecular formula C14H13BrClNO3S and a molecular weight of 390.69 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride.
| Compound Name | 5-bromo-3-methyl-2-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82911733 |
| Molecular Formula | C14H13BrClNO3S |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 5-bromo-3-methyl-2-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)Cl)c1OCCc1ccccn1 |
| InChI | InChI=1S/C14H13BrClNO3S/c1-10-8-11(15)9-13(21(16,18)19)14(10)20-7-5-12-4-2-3-6-17-12/h2-4,6,8-9H,5,7H2,1H3 |
| InChIKey | IKQIKMSDZZHSKO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |