C15H16ClNO3S — CID 82911972
2,6-dimethyl-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride (PubChem CID 82911972) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride.
| Compound Name | 2,6-dimethyl-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82911972 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2,6-dimethyl-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(OCCc2ccccn2)cc(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C15H16ClNO3S/c1-11-9-14(10-12(2)15(11)21(16,18)19)20-8-6-13-5-3-4-7-17-13/h3-5,7,9-10H,6,8H2,1-2H3 |
| InChIKey | DIVMLYDYDMQUCR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |