C13H10ClF2NO3S — CID 82911549
2,3-difluoro-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride (PubChem CID 82911549) has the molecular formula C13H10ClF2NO3S and a molecular weight of 333.74 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride.
| Compound Name | 2,3-difluoro-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82911549 |
| Molecular Formula | C13H10ClF2NO3S |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2,3-difluoro-4-(2-pyridin-2-ylethoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OCCc2ccccn2)c(F)c1F |
| InChI | InChI=1S/C13H10ClF2NO3S/c14-21(18,19)11-5-4-10(12(15)13(11)16)20-8-6-9-3-1-2-7-17-9/h1-5,7H,6,8H2 |
| InChIKey | JAFGGBAPPSVTTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |