C13H9ClF2O3S — CID 63036759
2,3-difluoro-4-phenylmethoxybenzenesulfonyl chloride (PubChem CID 63036759) has the molecular formula C13H9ClF2O3S and a molecular weight of 318.73 g/mol. Its IUPAC name is 2,3-difluoro-4-phenylmethoxybenzenesulfonyl chloride.
| Compound Name | 2,3-difluoro-4-phenylmethoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 63036759 |
| Molecular Formula | C13H9ClF2O3S |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2,3-difluoro-4-phenylmethoxybenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C13H9ClF2O3S/c14-20(17,18)11-7-6-10(12(15)13(11)16)19-8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | YXJWRBMNTUYSBP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |