C15H15Br2NO — CID 112621371
2-[2-[4-bromo-2-(bromomethyl)-6-methylphenoxy]ethyl]pyridine (PubChem CID 112621371) has the molecular formula C15H15Br2NO and a molecular weight of 385.10 g/mol. Its IUPAC name is 2-[2-[4-bromo-2-(bromomethyl)-6-methylphenoxy]ethyl]pyridine.
| Compound Name | 2-[2-[4-bromo-2-(bromomethyl)-6-methylphenoxy]ethyl]pyridine |
|---|---|
| PubChem CID | 112621371 |
| Molecular Formula | C15H15Br2NO |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 2-[2-[4-bromo-2-(bromomethyl)-6-methylphenoxy]ethyl]pyridine |
| SMILES | Cc1cc(Br)cc(CBr)c1OCCc1ccccn1 |
| InChI | InChI=1S/C15H15Br2NO/c1-11-8-13(17)9-12(10-16)15(11)19-7-5-14-4-2-3-6-18-14/h2-4,6,8-9H,5,7,10H2,1H3 |
| InChIKey | RNVNUOZPFRJXIU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|