C14H12BrCl2NO — CID 60891469
2-[2-[2-(bromomethyl)-4,6-dichlorophenoxy]ethyl]pyridine (PubChem CID 60891469) has the molecular formula C14H12BrCl2NO and a molecular weight of 361.07 g/mol. Its IUPAC name is 2-[2-[2-(bromomethyl)-4,6-dichlorophenoxy]ethyl]pyridine.
| Compound Name | 2-[2-[2-(bromomethyl)-4,6-dichlorophenoxy]ethyl]pyridine |
|---|---|
| PubChem CID | 60891469 |
| Molecular Formula | C14H12BrCl2NO |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-[2-[2-(bromomethyl)-4,6-dichlorophenoxy]ethyl]pyridine |
| SMILES | Clc1cc(Cl)c(OCCc2ccccn2)c(CBr)c1 |
| InChI | InChI=1S/C14H12BrCl2NO/c15-9-10-7-11(16)8-13(17)14(10)19-6-4-12-3-1-2-5-18-12/h1-3,5,7-8H,4,6,9H2 |
| InChIKey | BMQRSHYTNPFOEN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|