C14H9BrCl4O — CID 107306917
1-(bromomethyl)-3,5-dichloro-2-[(2,3-dichlorophenyl)methoxy]benzene (PubChem CID 107306917) has the molecular formula C14H9BrCl4O and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-dichloro-2-[(2,3-dichlorophenyl)methoxy]benzene.
| Compound Name | 1-(bromomethyl)-3,5-dichloro-2-[(2,3-dichlorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 107306917 |
| Molecular Formula | C14H9BrCl4O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 411.86 |
| IUPAC Name | 1-(bromomethyl)-3,5-dichloro-2-[(2,3-dichlorophenyl)methoxy]benzene |
| SMILES | Clc1cc(Cl)c(OCc2cccc(Cl)c2Cl)c(CBr)c1 |
| InChI | InChI=1S/C14H9BrCl4O/c15-6-9-4-10(16)5-12(18)14(9)20-7-8-2-1-3-11(17)13(8)19/h1-5H,6-7H2 |
| InChIKey | OFWXCGWTGSLLAM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|