About 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene
1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene (PubChem CID 43516371) has the molecular formula C15H13BrCl2O
and a molecular weight of 360.08 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene |
| PubChem CID | 43516371 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene |
| SMILES | Clc1cc(Cl)c(OCCc2ccccc2)c(CBr)c1 |
| InChI | InChI=1S/C15H13BrCl2O/c16-10-12-8-13(17)9-14(18)15(12)19-7-6-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2 |
| InChIKey | UOABHNGSCPDYAV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene?
The IUPAC name of 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene (CID 43516371) is 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene.
What is the SMILES notation for 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene?
The canonical SMILES for 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene is Clc1cc(Cl)c(OCCc2ccccc2)c(CBr)c1.
What is the InChIKey of 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene?
The InChIKey is UOABHNGSCPDYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrCl2O/c16-10-12-8-13(17)9-14(18)15(12)19-7-6-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2.
What are the key properties of 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene?
1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene has a molecular weight of 360.08 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3,5-dichloro-2-(2-phenylethoxy)benzene is sourced from PubChem (CID 43516371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).