C9H6BrCl2NO — CID 22241513
2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile (PubChem CID 22241513) has the molecular formula C9H6BrCl2NO and a molecular weight of 294.96 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile.
| Compound Name | 2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 22241513 |
| Molecular Formula | C9H6BrCl2NO |
| Molecular Weight | 294.96 g/mol |
| Exact Mass | 292.90 |
| IUPAC Name | 2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile |
| SMILES | N#CCOc1c(Cl)cc(Cl)cc1CBr |
| InChI | InChI=1S/C9H6BrCl2NO/c10-5-6-3-7(11)4-8(12)9(6)14-2-1-13/h3-4H,2,5H2 |
| InChIKey | YGYLYDPPSJSHDL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|