C11H10BrCl2F3O — CID 115514411
1-(bromomethyl)-3,5-dichloro-2-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115514411) has the molecular formula C11H10BrCl2F3O and a molecular weight of 366.00 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-dichloro-2-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 1-(bromomethyl)-3,5-dichloro-2-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115514411 |
| Molecular Formula | C11H10BrCl2F3O |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 1-(bromomethyl)-3,5-dichloro-2-(4,4,4-trifluorobutoxy)benzene |
| SMILES | FC(F)(F)CCCOc1c(Cl)cc(Cl)cc1CBr |
| InChI | InChI=1S/C11H10BrCl2F3O/c12-6-7-4-8(13)5-9(14)10(7)18-3-1-2-11(15,16)17/h4-5H,1-3,6H2 |
| InChIKey | UCDNETZYAPTXAT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|