C11H13ClF3NO — CID 112607694
[3-chloro-2-(4,4,4-trifluorobutoxy)phenyl]methanamine (PubChem CID 112607694) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is [3-chloro-2-(4,4,4-trifluorobutoxy)phenyl]methanamine.
| Compound Name | [3-chloro-2-(4,4,4-trifluorobutoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 112607694 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [3-chloro-2-(4,4,4-trifluorobutoxy)phenyl]methanamine |
| SMILES | NCc1cccc(Cl)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO/c12-9-4-1-3-8(7-16)10(9)17-6-2-5-11(13,14)15/h1,3-4H,2,5-7,16H2 |
| InChIKey | WEDLLXVNUYURKO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|