C13H17ClF3NO2 — CID 115954964
N-[[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 115954964) has the molecular formula C13H17ClF3NO2 and a molecular weight of 311.73 g/mol. Its IUPAC name is N-[[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 115954964 |
| Molecular Formula | C13H17ClF3NO2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccc(Cl)c1OCCC(F)(F)F |
| InChI | InChI=1S/C13H17ClF3NO2/c1-19-8-6-18-9-10-3-2-4-11(14)12(10)20-7-5-13(15,16)17/h2-4,18H,5-9H2,1H3 |
| InChIKey | WFNQZEZHDPKWEZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|