C14H18ClN3O3 — CID 115954899
N-[[3-chloro-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methyl]-2-methoxyethanamine (PubChem CID 115954899) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-[[3-chloro-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 115954899 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[[3-chloro-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccc(Cl)c1OCc1noc(C)n1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-10-17-13(18-21-10)9-20-14-11(4-3-5-12(14)15)8-16-6-7-19-2/h3-5,16H,6-9H2,1-2H3 |
| InChIKey | SHIQHTFCWPTYGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|