C11H13ClF3NO — CID 112614997
2-[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]ethanamine (PubChem CID 112614997) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 2-[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]ethanamine.
| Compound Name | 2-[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 112614997 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[3-chloro-2-(3,3,3-trifluoropropoxy)phenyl]ethanamine |
| SMILES | NCCc1cccc(Cl)c1OCCC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO/c12-9-3-1-2-8(4-6-16)10(9)17-7-5-11(13,14)15/h1-3H,4-7,16H2 |
| InChIKey | NUYOUHALQHWLMI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |