C12H14ClF3O3 — CID 112612892
[3-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]methanol (PubChem CID 112612892) has the molecular formula C12H14ClF3O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is [3-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]methanol.
| Compound Name | [3-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]methanol |
|---|---|
| PubChem CID | 112612892 |
| Molecular Formula | C12H14ClF3O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [3-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]methanol |
| SMILES | OCc1cccc(Cl)c1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14ClF3O3/c13-10-4-1-3-9(7-17)11(10)19-6-2-5-18-8-12(14,15)16/h1,3-4,17H,2,5-8H2 |
| InChIKey | LXJHNJYUMKZZEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|