C13H16ClF3O2 — CID 112613319
1-(chloromethyl)-3-methyl-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene (PubChem CID 112613319) has the molecular formula C13H16ClF3O2 and a molecular weight of 296.72 g/mol. Its IUPAC name is 1-(chloromethyl)-3-methyl-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene.
| Compound Name | 1-(chloromethyl)-3-methyl-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
|---|---|
| PubChem CID | 112613319 |
| Molecular Formula | C13H16ClF3O2 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(chloromethyl)-3-methyl-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
| SMILES | Cc1cccc(CCl)c1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H16ClF3O2/c1-10-4-2-5-11(8-14)12(10)19-7-3-6-18-9-13(15,16)17/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | BAUDBILQVLCIAX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|