C13H15Cl2F3O2 — CID 140992298
1,3-dichloro-2-[5-(2,2,2-trifluoroethoxy)pentoxy]benzene (PubChem CID 140992298) has the molecular formula C13H15Cl2F3O2 and a molecular weight of 331.16 g/mol. Its IUPAC name is 1,3-dichloro-2-[5-(2,2,2-trifluoroethoxy)pentoxy]benzene.
| Compound Name | 1,3-dichloro-2-[5-(2,2,2-trifluoroethoxy)pentoxy]benzene |
|---|---|
| PubChem CID | 140992298 |
| Molecular Formula | C13H15Cl2F3O2 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1,3-dichloro-2-[5-(2,2,2-trifluoroethoxy)pentoxy]benzene |
| SMILES | FC(F)(F)COCCCCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2F3O2/c14-10-5-4-6-11(15)12(10)20-8-3-1-2-7-19-9-13(16,17)18/h4-6H,1-3,7-9H2 |
| InChIKey | HXJCBAPKEKYIPJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|