C14H19ClF3NO2 — CID 114321854
1-[2-chloro-6-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-amine (PubChem CID 114321854) has the molecular formula C14H19ClF3NO2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 1-[2-chloro-6-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-amine.
| Compound Name | 1-[2-chloro-6-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-amine |
|---|---|
| PubChem CID | 114321854 |
| Molecular Formula | C14H19ClF3NO2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[2-chloro-6-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-amine |
| SMILES | CC(N)Cc1c(Cl)cccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H19ClF3NO2/c1-10(19)8-11-12(15)4-2-5-13(11)21-7-3-6-20-9-14(16,17)18/h2,4-5,10H,3,6-9,19H2,1H3 |
| InChIKey | ZQVOMTXRXZTUQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|