C11H9ClF3NO2 — CID 79035063
2-chloro-6-[2-(2,2,2-trifluoroethoxy)ethoxy]benzonitrile (PubChem CID 79035063) has the molecular formula C11H9ClF3NO2 and a molecular weight of 279.64 g/mol. Its IUPAC name is 2-chloro-6-[2-(2,2,2-trifluoroethoxy)ethoxy]benzonitrile.
| Compound Name | 2-chloro-6-[2-(2,2,2-trifluoroethoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 79035063 |
| Molecular Formula | C11H9ClF3NO2 |
| Molecular Weight | 279.64 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-chloro-6-[2-(2,2,2-trifluoroethoxy)ethoxy]benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C11H9ClF3NO2/c12-9-2-1-3-10(8(9)6-16)18-5-4-17-7-11(13,14)15/h1-3H,4-5,7H2 |
| InChIKey | BSMMYVCOWXHQPF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|