C11H12ClF3O2 — CID 121390824
2-chloro-4-methyl-1-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 121390824) has the molecular formula C11H12ClF3O2 and a molecular weight of 268.66 g/mol. Its IUPAC name is 2-chloro-4-methyl-1-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 2-chloro-4-methyl-1-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 121390824 |
| Molecular Formula | C11H12ClF3O2 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-chloro-4-methyl-1-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | Cc1ccc(OCCOCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClF3O2/c1-8-2-3-10(9(12)6-8)17-5-4-16-7-11(13,14)15/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | GBDJAQGUCDMICQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|