C10H11BrF3NO2 — CID 65429422
5-bromo-2-[2-(2,2,2-trifluoroethoxy)ethoxy]aniline (PubChem CID 65429422) has the molecular formula C10H11BrF3NO2 and a molecular weight of 314.10 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2,2-trifluoroethoxy)ethoxy]aniline.
| Compound Name | 5-bromo-2-[2-(2,2,2-trifluoroethoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 65429422 |
| Molecular Formula | C10H11BrF3NO2 |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-bromo-2-[2-(2,2,2-trifluoroethoxy)ethoxy]aniline |
| SMILES | Nc1cc(Br)ccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C10H11BrF3NO2/c11-7-1-2-9(8(15)5-7)17-4-3-16-6-10(12,13)14/h1-2,5H,3-4,6,15H2 |
| InChIKey | WLJRIOHUZQVLRM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|