C11H13BrF3NO2S — CID 81184558
5-bromo-2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]aniline (PubChem CID 81184558) has the molecular formula C11H13BrF3NO2S and a molecular weight of 360.20 g/mol. Its IUPAC name is 5-bromo-2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]aniline.
| Compound Name | 5-bromo-2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]aniline |
|---|---|
| PubChem CID | 81184558 |
| Molecular Formula | C11H13BrF3NO2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 5-bromo-2-[3-(2,2,2-trifluoroethoxy)propylsulfinyl]aniline |
| SMILES | Nc1cc(Br)ccc1S(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO2S/c12-8-2-3-10(9(16)6-8)19(17)5-1-4-18-7-11(13,14)15/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | ZSSAHZGBZLUCGV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|