About 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline
5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline (PubChem CID 81176043) has the molecular formula C10H9F6NOS
and a molecular weight of 305.24 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline |
| PubChem CID | 81176043 |
| Molecular Formula | C10H9F6NOS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1S(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H9F6NOS/c11-9(12,13)3-4-19(18)8-2-1-6(5-7(8)17)10(14,15)16/h1-2,5H,3-4,17H2 |
| InChIKey | LHYROHYXBYABRL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline?
The IUPAC name of 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline (CID 81176043) is 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline.
What is the SMILES notation for 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline?
The canonical SMILES for 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline is Nc1cc(C(F)(F)F)ccc1S(=O)CCC(F)(F)F.
What is the InChIKey of 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline?
The InChIKey is LHYROHYXBYABRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F6NOS/c11-9(12,13)3-4-19(18)8-2-1-6(5-7(8)17)10(14,15)16/h1-2,5H,3-4,17H2.
What are the key properties of 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline?
5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline has a molecular weight of 305.24 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-2-(3,3,3-trifluoropropylsulfinyl)aniline is sourced from PubChem (CID 81176043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).