C10H11F3N2O2S — CID 81175290
2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-methylacetamide (PubChem CID 81175290) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-methylacetamide.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-methylacetamide |
|---|---|
| PubChem CID | 81175290 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C10H11F3N2O2S/c1-15-9(16)5-18(17)8-3-2-6(4-7(8)14)10(11,12)13/h2-4H,5,14H2,1H3,(H,15,16) |
| InChIKey | HVNFMOUQOJNHHP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|