C13H15F3N2O2S — CID 81176174
2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-cyclopropyl-N-methylacetamide (PubChem CID 81176174) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 81176174 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfinyl-N-cyclopropyl-N-methylacetamide |
| SMILES | CN(C(=O)CS(=O)c1ccc(C(F)(F)F)cc1N)C1CC1 |
| InChI | InChI=1S/C13H15F3N2O2S/c1-18(9-3-4-9)12(19)7-21(20)11-5-2-8(6-10(11)17)13(14,15)16/h2,5-6,9H,3-4,7,17H2,1H3 |
| InChIKey | BSPOTPIYWVLCMO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|