C9H7F6NOS — CID 81176557
2-(2,2,2-trifluoroethylsulfinyl)-5-(trifluoromethyl)aniline (PubChem CID 81176557) has the molecular formula C9H7F6NOS and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfinyl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(2,2,2-trifluoroethylsulfinyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81176557 |
| Molecular Formula | C9H7F6NOS |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfinyl)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1S(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H7F6NOS/c10-8(11,12)4-18(17)7-2-1-5(3-6(7)16)9(13,14)15/h1-3H,4,16H2 |
| InChIKey | YNWHWCGWGBABAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|