C11H14F3NO3S2 — CID 81175916
2-(2-ethylsulfonylethylsulfinyl)-5-(trifluoromethyl)aniline (PubChem CID 81175916) has the molecular formula C11H14F3NO3S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethylsulfinyl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(2-ethylsulfonylethylsulfinyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81175916 |
| Molecular Formula | C11H14F3NO3S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(2-ethylsulfonylethylsulfinyl)-5-(trifluoromethyl)aniline |
| SMILES | CCS(=O)(=O)CCS(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H14F3NO3S2/c1-2-20(17,18)6-5-19(16)10-4-3-8(7-9(10)15)11(12,13)14/h3-4,7H,2,5-6,15H2,1H3 |
| InChIKey | ZLOFVDDSQRXGTE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|