C13H16BrF3O3 — CID 62379554
1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanol (PubChem CID 62379554) has the molecular formula C13H16BrF3O3 and a molecular weight of 357.17 g/mol. Its IUPAC name is 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanol.
| Compound Name | 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 62379554 |
| Molecular Formula | C13H16BrF3O3 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanol |
| SMILES | CC(O)c1cc(Br)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H16BrF3O3/c1-9(18)11-7-10(14)3-4-12(11)20-6-2-5-19-8-13(15,16)17/h3-4,7,9,18H,2,5-6,8H2,1H3 |
| InChIKey | ANBMZAAGGAJFLW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|