C14H19BrF3NO2 — CID 62393265
1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]-N-methylethanamine (PubChem CID 62393265) has the molecular formula C14H19BrF3NO2 and a molecular weight of 370.21 g/mol. Its IUPAC name is 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]-N-methylethanamine.
| Compound Name | 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 62393265 |
| Molecular Formula | C14H19BrF3NO2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[5-bromo-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1cc(Br)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO2/c1-10(19-2)12-8-11(15)4-5-13(12)21-7-3-6-20-9-14(16,17)18/h4-5,8,10,19H,3,6-7,9H2,1-2H3 |
| InChIKey | UEFCHMHQJAEEOW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|